C15H20N4O4 — CID 7543831
methyl N-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]carbamate (PubChem CID 7543831) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl N-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]carbamate.
| Compound Name | methyl N-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]carbamate |
|---|---|
| PubChem CID | 7543831 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl N-[[(3R)-1-(3,4-dimethylphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]carbamate |
| SMILES | COC(=O)NNC(=O)N[C@@H]1CC(=O)N(c2ccc(C)c(C)c2)C1 |
| InChI | InChI=1S/C15H20N4O4/c1-9-4-5-12(6-10(9)2)19-8-11(7-13(19)20)16-14(21)17-18-15(22)23-3/h4-6,11H,7-8H2,1-3H3,(H,18,22)(H2,16,17,21)/t11-/m1/s1 |
| InChIKey | ZDOJTADVEDRQIK-LLVKDONJSA-N |
| XLogP | 0.98 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|