About N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide
N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide (PubChem CID 75438784) has the molecular formula C15H14ClN3O3
and a molecular weight of 319.75 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide |
| PubChem CID | 75438784 |
| Molecular Formula | C15H14ClN3O3 |
| Molecular Weight | 319.75 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide |
| SMILES | CN1C(=O)CC(NC(=O)c2ccon2)C1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H14ClN3O3/c1-19-13(20)8-12(17-15(21)11-6-7-22-18-11)14(19)9-2-4-10(16)5-3-9/h2-7,12,14H,8H2,1H3,(H,17,21) |
| InChIKey | VCMHCFCUJATMAA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.75 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide?
The IUPAC name of N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide (CID 75438784) is N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide is CN1C(=O)CC(NC(=O)c2ccon2)C1c1ccc(Cl)cc1.
What is the InChIKey of N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide?
The InChIKey is VCMHCFCUJATMAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14ClN3O3/c1-19-13(20)8-12(17-15(21)11-6-7-22-18-11)14(19)9-2-4-10(16)5-3-9/h2-7,12,14H,8H2,1H3,(H,17,21).
What are the key properties of N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide?
N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide has a molecular weight of 319.75 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(4-chlorophenyl)-1-methyl-5-oxopyrrolidin-3-yl]-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 75438784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).