C17H19Cl2N3O — CID 75439020
N-(2,5-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]propanamide (PubChem CID 75439020) has the molecular formula C17H19Cl2N3O and a molecular weight of 352.27 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]propanamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]propanamide |
|---|---|
| PubChem CID | 75439020 |
| Molecular Formula | C17H19Cl2N3O |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[methyl(2-pyridin-4-ylethyl)amino]propanamide |
| SMILES | CC(C(=O)Nc1cc(Cl)ccc1Cl)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C17H19Cl2N3O/c1-12(22(2)10-7-13-5-8-20-9-6-13)17(23)21-16-11-14(18)3-4-15(16)19/h3-6,8-9,11-12H,7,10H2,1-2H3,(H,21,23) |
| InChIKey | JVRDHKZTBLBBCE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |