About 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile
3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile (PubChem CID 75439243) has the molecular formula C17H20N4O2S
and a molecular weight of 344.44 g/mol. Its IUPAC name is 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile.
Molecular Properties
| Compound Name | 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile |
| PubChem CID | 75439243 |
| Molecular Formula | C17H20N4O2S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile |
| SMILES | N#CCCn1cc(CN2CCS(=O)(=O)CC2)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H20N4O2S/c18-7-4-8-21-14-16(13-20-9-11-24(22,23)12-10-20)17(19-21)15-5-2-1-3-6-15/h1-3,5-6,14H,4,8-13H2 |
| InChIKey | JIWRGCHVGLWSGS-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile?
The IUPAC name of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile (CID 75439243) is 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile.
What is the SMILES notation for 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile?
The canonical SMILES for 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile is N#CCCn1cc(CN2CCS(=O)(=O)CC2)c(-c2ccccc2)n1.
What is the InChIKey of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile?
The InChIKey is JIWRGCHVGLWSGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N4O2S/c18-7-4-8-21-14-16(13-20-9-11-24(22,23)12-10-20)17(19-21)15-5-2-1-3-6-15/h1-3,5-6,14H,4,8-13H2.
What are the key properties of 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile?
3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile has a molecular weight of 344.44 g/mol, XLogP of 1.69, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(1,1-dioxo-1,4-thiazinan-4-yl)methyl]-3-phenylpyrazol-1-yl]propanenitrile is sourced from PubChem (CID 75439243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).