C12H10BrN3O4 — CID 75440008
N-(4-bromo-3-nitrophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide (PubChem CID 75440008) has the molecular formula C12H10BrN3O4 and a molecular weight of 340.13 g/mol. Its IUPAC name is N-(4-bromo-3-nitrophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide.
| Compound Name | N-(4-bromo-3-nitrophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 75440008 |
| Molecular Formula | C12H10BrN3O4 |
| Molecular Weight | 340.13 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | N-(4-bromo-3-nitrophenyl)-2,4-dimethyl-1,3-oxazole-5-carboxamide |
| SMILES | Cc1nc(C)c(C(=O)Nc2ccc(Br)c([N+](=O)[O-])c2)o1 |
| InChI | InChI=1S/C12H10BrN3O4/c1-6-11(20-7(2)14-6)12(17)15-8-3-4-9(13)10(5-8)16(18)19/h3-5H,1-2H3,(H,15,17) |
| InChIKey | UPQRLYOXHUGBIF-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.13 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|