About N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine
N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine (PubChem CID 75440090) has the molecular formula C20H32N2O3
and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine.
Molecular Properties
| Compound Name | N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine |
| PubChem CID | 75440090 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine |
| SMILES | COc1cc(N2CCOC(C)(C)C2)ccc1NC1CC(C)OC(C)C1 |
| InChI | InChI=1S/C20H32N2O3/c1-14-10-16(11-15(2)25-14)21-18-7-6-17(12-19(18)23-5)22-8-9-24-20(3,4)13-22/h6-7,12,14-16,21H,8-11,13H2,1-5H3 |
| InChIKey | HHGVACGMAFAVDY-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine?
The IUPAC name of N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine (CID 75440090) is N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine.
What is the SMILES notation for N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine?
The canonical SMILES for N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine is COc1cc(N2CCOC(C)(C)C2)ccc1NC1CC(C)OC(C)C1.
What is the InChIKey of N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine?
The InChIKey is HHGVACGMAFAVDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H32N2O3/c1-14-10-16(11-15(2)25-14)21-18-7-6-17(12-19(18)23-5)22-8-9-24-20(3,4)13-22/h6-7,12,14-16,21H,8-11,13H2,1-5H3.
What are the key properties of N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine?
N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine has a molecular weight of 348.49 g/mol, XLogP of 3.68, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,2-dimethylmorpholin-4-yl)-2-methoxyphenyl]-2,6-dimethyloxan-4-amine is sourced from PubChem (CID 75440090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).