C16H16FN3O4 — CID 75440273
methyl 5-[1-(2-fluoro-6-methoxyphenyl)ethylcarbamoyl]pyrazine-2-carboxylate (PubChem CID 75440273) has the molecular formula C16H16FN3O4 and a molecular weight of 333.32 g/mol. Its IUPAC name is methyl 5-[1-(2-fluoro-6-methoxyphenyl)ethylcarbamoyl]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[1-(2-fluoro-6-methoxyphenyl)ethylcarbamoyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 75440273 |
| Molecular Formula | C16H16FN3O4 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | methyl 5-[1-(2-fluoro-6-methoxyphenyl)ethylcarbamoyl]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(C(=O)NC(C)c2c(F)cccc2OC)cn1 |
| InChI | InChI=1S/C16H16FN3O4/c1-9(14-10(17)5-4-6-13(14)23-2)20-15(21)11-7-19-12(8-18-11)16(22)24-3/h4-9H,1-3H3,(H,20,21) |
| InChIKey | FJQDVRHWRDWRFZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |