About 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile
2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile (PubChem CID 75440799) has the molecular formula C18H21N3
and a molecular weight of 279.39 g/mol. Its IUPAC name is 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile.
Molecular Properties
| Compound Name | 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile |
| PubChem CID | 75440799 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile |
| SMILES | Cc1cccc(C2=CCN(CC(C#N)CCC#N)CC2)c1 |
| InChI | InChI=1S/C18H21N3/c1-15-4-2-6-18(12-15)17-7-10-21(11-8-17)14-16(13-20)5-3-9-19/h2,4,6-7,12,16H,3,5,8,10-11,14H2,1H3 |
| InChIKey | DBTKCDGUOATRRV-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 50.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile?
The IUPAC name of 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile (CID 75440799) is 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile.
What is the SMILES notation for 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile?
The canonical SMILES for 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile is Cc1cccc(C2=CCN(CC(C#N)CCC#N)CC2)c1.
What is the InChIKey of 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile?
The InChIKey is DBTKCDGUOATRRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21N3/c1-15-4-2-6-18(12-15)17-7-10-21(11-8-17)14-16(13-20)5-3-9-19/h2,4,6-7,12,16H,3,5,8,10-11,14H2,1H3.
What are the key properties of 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile?
2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile has a molecular weight of 279.39 g/mol, XLogP of 3.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-(3-methylphenyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]pentanedinitrile is sourced from PubChem (CID 75440799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).