About 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide
2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide (PubChem CID 75441137) has the molecular formula C18H24BrNO3
and a molecular weight of 382.30 g/mol. Its IUPAC name is 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide.
Molecular Properties
| Compound Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide |
| PubChem CID | 75441137 |
| Molecular Formula | C18H24BrNO3 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)Cc1cc(OCC)c(OCC)cc1Br)C1CC1 |
| InChI | InChI=1S/C18H24BrNO3/c1-4-9-20(14-7-8-14)18(21)11-13-10-16(22-5-2)17(23-6-3)12-15(13)19/h4,10,12,14H,1,5-9,11H2,2-3H3 |
| InChIKey | PXOMJFKAKPRSTM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide?
The IUPAC name of 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide (CID 75441137) is 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide.
What is the SMILES notation for 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide?
The canonical SMILES for 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide is C=CCN(C(=O)Cc1cc(OCC)c(OCC)cc1Br)C1CC1.
What is the InChIKey of 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide?
The InChIKey is PXOMJFKAKPRSTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BrNO3/c1-4-9-20(14-7-8-14)18(21)11-13-10-16(22-5-2)17(23-6-3)12-15(13)19/h4,10,12,14H,1,5-9,11H2,2-3H3.
What are the key properties of 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide?
2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide has a molecular weight of 382.30 g/mol, XLogP of 3.97, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-bromo-4,5-diethoxyphenyl)-N-cyclopropyl-N-prop-2-enylacetamide is sourced from PubChem (CID 75441137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).