C18H20N4OS — CID 75441738
3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)methylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole (PubChem CID 75441738) has the molecular formula C18H20N4OS and a molecular weight of 340.45 g/mol. Its IUPAC name is 3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)methylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole.
| Compound Name | 3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)methylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
|---|---|
| PubChem CID | 75441738 |
| Molecular Formula | C18H20N4OS |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)methylsulfanylmethyl]-4,5,6,7-tetrahydro-1,2-benzoxazole |
| SMILES | Cn1c(CSCc2noc3c2CCCC3)nnc1-c1ccccc1 |
| InChI | InChI=1S/C18H20N4OS/c1-22-17(19-20-18(22)13-7-3-2-4-8-13)12-24-11-15-14-9-5-6-10-16(14)23-21-15/h2-4,7-8H,5-6,9-12H2,1H3 |
| InChIKey | IIJXTKVJNWTMIL-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 56.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |