C18H25FN2O — CID 75442320
1-[3-fluoro-4-(4-hex-5-en-2-ylpiperazin-1-yl)phenyl]ethanone (PubChem CID 75442320) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is 1-[3-fluoro-4-(4-hex-5-en-2-ylpiperazin-1-yl)phenyl]ethanone.
| Compound Name | 1-[3-fluoro-4-(4-hex-5-en-2-ylpiperazin-1-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 75442320 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-[3-fluoro-4-(4-hex-5-en-2-ylpiperazin-1-yl)phenyl]ethanone |
| SMILES | C=CCCC(C)N1CCN(c2ccc(C(C)=O)cc2F)CC1 |
| InChI | InChI=1S/C18H25FN2O/c1-4-5-6-14(2)20-9-11-21(12-10-20)18-8-7-16(15(3)22)13-17(18)19/h4,7-8,13-14H,1,5-6,9-12H2,2-3H3 |
| InChIKey | PLUDQUCRNNUQJR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|