C16H18N4O2S — CID 75442393
5-methyl-3-[3-(2-methyl-1,3-thiazol-4-yl)propyl]-5-pyridin-3-ylimidazolidine-2,4-dione (PubChem CID 75442393) has the molecular formula C16H18N4O2S and a molecular weight of 330.41 g/mol. Its IUPAC name is 5-methyl-3-[3-(2-methyl-1,3-thiazol-4-yl)propyl]-5-pyridin-3-ylimidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[3-(2-methyl-1,3-thiazol-4-yl)propyl]-5-pyridin-3-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75442393 |
| Molecular Formula | C16H18N4O2S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 5-methyl-3-[3-(2-methyl-1,3-thiazol-4-yl)propyl]-5-pyridin-3-ylimidazolidine-2,4-dione |
| SMILES | Cc1nc(CCCN2C(=O)NC(C)(c3cccnc3)C2=O)cs1 |
| InChI | InChI=1S/C16H18N4O2S/c1-11-18-13(10-23-11)6-4-8-20-14(21)16(2,19-15(20)22)12-5-3-7-17-9-12/h3,5,7,9-10H,4,6,8H2,1-2H3,(H,19,22) |
| InChIKey | JEFQTWJGRKEKLO-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|