About 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol
2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol (PubChem CID 75442495) has the molecular formula C18H23FN4O
and a molecular weight of 330.41 g/mol. Its IUPAC name is 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol.
Molecular Properties
| Compound Name | 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol |
| PubChem CID | 75442495 |
| Molecular Formula | C18H23FN4O |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol |
| SMILES | OC(CN1CCCC(c2nncn2C2CC2)C1)c1ccccc1F |
| InChI | InChI=1S/C18H23FN4O/c19-16-6-2-1-5-15(16)17(24)11-22-9-3-4-13(10-22)18-21-20-12-23(18)14-7-8-14/h1-2,5-6,12-14,17,24H,3-4,7-11H2 |
| InChIKey | MGBOIVKIWHAVIA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol?
The IUPAC name of 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol (CID 75442495) is 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol.
What is the SMILES notation for 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol?
The canonical SMILES for 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol is OC(CN1CCCC(c2nncn2C2CC2)C1)c1ccccc1F.
What is the InChIKey of 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol?
The InChIKey is MGBOIVKIWHAVIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23FN4O/c19-16-6-2-1-5-15(16)17(24)11-22-9-3-4-13(10-22)18-21-20-12-23(18)14-7-8-14/h1-2,5-6,12-14,17,24H,3-4,7-11H2.
What are the key properties of 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol?
2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol has a molecular weight of 330.41 g/mol, XLogP of 2.67, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-cyclopropyl-1,2,4-triazol-3-yl)piperidin-1-yl]-1-(2-fluorophenyl)ethanol is sourced from PubChem (CID 75442495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).