About 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine
5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine (PubChem CID 75442542) has the molecular formula C14H17N3O2S2
and a molecular weight of 323.44 g/mol. Its IUPAC name is 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine.
Molecular Properties
| Compound Name | 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine |
| PubChem CID | 75442542 |
| Molecular Formula | C14H17N3O2S2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine |
| SMILES | CCn1cc(S(=O)(=O)N2CCCSc3ccccc32)cn1 |
| InChI | InChI=1S/C14H17N3O2S2/c1-2-16-11-12(10-15-16)21(18,19)17-8-5-9-20-14-7-4-3-6-13(14)17/h3-4,6-7,10-11H,2,5,8-9H2,1H3 |
| InChIKey | NWZVDKYAOJMQIG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine?
The IUPAC name of 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine (CID 75442542) is 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine.
What is the SMILES notation for 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine?
The canonical SMILES for 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine is CCn1cc(S(=O)(=O)N2CCCSc3ccccc32)cn1.
What is the InChIKey of 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine?
The InChIKey is NWZVDKYAOJMQIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3O2S2/c1-2-16-11-12(10-15-16)21(18,19)17-8-5-9-20-14-7-4-3-6-13(14)17/h3-4,6-7,10-11H,2,5,8-9H2,1H3.
What are the key properties of 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine?
5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine has a molecular weight of 323.44 g/mol, XLogP of 2.59, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-ethylpyrazol-4-yl)sulfonyl-3,4-dihydro-2H-1,5-benzothiazepine is sourced from PubChem (CID 75442542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).