About tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate
tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate (PubChem CID 75442711) has the molecular formula C18H32N4O2
and a molecular weight of 336.48 g/mol. Its IUPAC name is tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate |
| PubChem CID | 75442711 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate |
| SMILES | Cc1nn(C)c(C)c1CCCNC1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H32N4O2/c1-13-16(14(2)21(6)20-13)8-7-10-19-15-9-11-22(12-15)17(23)24-18(3,4)5/h15,19H,7-12H2,1-6H3 |
| InChIKey | GXWVFYUVFLXAAR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate (CID 75442711) is tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate is Cc1nn(C)c(C)c1CCCNC1CCN(C(=O)OC(C)(C)C)C1.
What is the InChIKey of tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate?
The InChIKey is GXWVFYUVFLXAAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32N4O2/c1-13-16(14(2)21(6)20-13)8-7-10-19-15-9-11-22(12-15)17(23)24-18(3,4)5/h15,19H,7-12H2,1-6H3.
What are the key properties of tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate?
tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate has a molecular weight of 336.48 g/mol, XLogP of 2.57, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[3-(1,3,5-trimethylpyrazol-4-yl)propylamino]pyrrolidine-1-carboxylate is sourced from PubChem (CID 75442711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).