About 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea
1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea (PubChem CID 75443022) has the molecular formula C16H32N2O2
and a molecular weight of 284.44 g/mol. Its IUPAC name is 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea.
Molecular Properties
| Compound Name | 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea |
| PubChem CID | 75443022 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea |
| SMILES | CC(C)(C)CN(CC(C)(C)C)C(=O)NC1CCOCC1 |
| InChI | InChI=1S/C16H32N2O2/c1-15(2,3)11-18(12-16(4,5)6)14(19)17-13-7-9-20-10-8-13/h13H,7-12H2,1-6H3,(H,17,19) |
| InChIKey | SIRKWYLQWQKWOO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea?
The IUPAC name of 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea (CID 75443022) is 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea.
What is the SMILES notation for 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea?
The canonical SMILES for 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea is CC(C)(C)CN(CC(C)(C)C)C(=O)NC1CCOCC1.
What is the InChIKey of 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea?
The InChIKey is SIRKWYLQWQKWOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O2/c1-15(2,3)11-18(12-16(4,5)6)14(19)17-13-7-9-20-10-8-13/h13H,7-12H2,1-6H3,(H,17,19).
What are the key properties of 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea?
1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea has a molecular weight of 284.44 g/mol, XLogP of 3.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(2,2-dimethylpropyl)-3-(oxan-4-yl)urea is sourced from PubChem (CID 75443022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).