About 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile
4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile (PubChem CID 75443727) has the molecular formula C14H23N5O2S
and a molecular weight of 325.44 g/mol. Its IUPAC name is 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile.
Molecular Properties
| Compound Name | 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile |
| PubChem CID | 75443727 |
| Molecular Formula | C14H23N5O2S |
| Molecular Weight | 325.44 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile |
| SMILES | CC(C)n1cnnc1C1CCCN(S(=O)(=O)CCCC#N)C1 |
| InChI | InChI=1S/C14H23N5O2S/c1-12(2)19-11-16-17-14(19)13-6-5-8-18(10-13)22(20,21)9-4-3-7-15/h11-13H,3-6,8-10H2,1-2H3 |
| InChIKey | CHWZDRJZGAXPDH-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 91.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile?
The IUPAC name of 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile (CID 75443727) is 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile.
What is the SMILES notation for 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile?
The canonical SMILES for 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile is CC(C)n1cnnc1C1CCCN(S(=O)(=O)CCCC#N)C1.
What is the InChIKey of 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile?
The InChIKey is CHWZDRJZGAXPDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N5O2S/c1-12(2)19-11-16-17-14(19)13-6-5-8-18(10-13)22(20,21)9-4-3-7-15/h11-13H,3-6,8-10H2,1-2H3.
What are the key properties of 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile?
4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile has a molecular weight of 325.44 g/mol, XLogP of 1.67, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(4-propan-2-yl-1,2,4-triazol-3-yl)piperidin-1-yl]sulfonylbutanenitrile is sourced from PubChem (CID 75443727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).