About 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide
4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide (PubChem CID 75444382) has the molecular formula C11H12F2N2O3S
and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide |
| PubChem CID | 75444382 |
| Molecular Formula | C11H12F2N2O3S |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1c(F)cc(C#N)cc1F |
| InChI | InChI=1S/C11H12F2N2O3S/c1-2-8(6-16)15-19(17,18)11-9(12)3-7(5-14)4-10(11)13/h3-4,8,15-16H,2,6H2,1H3/t8-/m1/s1 |
| InChIKey | PXXAIFWNSCJMGZ-MRVPVSSYSA-N |
| XLogP | 0.89 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide?
The IUPAC name of 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide (CID 75444382) is 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide.
What is the SMILES notation for 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide?
The canonical SMILES for 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide is CC[C@H](CO)NS(=O)(=O)c1c(F)cc(C#N)cc1F.
What is the InChIKey of 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide?
The InChIKey is PXXAIFWNSCJMGZ-MRVPVSSYSA-N. The full InChI is InChI=1S/C11H12F2N2O3S/c1-2-8(6-16)15-19(17,18)11-9(12)3-7(5-14)4-10(11)13/h3-4,8,15-16H,2,6H2,1H3/t8-/m1/s1.
What are the key properties of 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide?
4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide has a molecular weight of 290.29 g/mol, XLogP of 0.89, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-2,6-difluoro-N-[(2R)-1-hydroxybutan-2-yl]benzenesulfonamide is sourced from PubChem (CID 75444382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).