C19H26N2O2 — CID 75444716
1-ethyl-N-[[1-(1-hydroxy-2-methylpropyl)cyclopropyl]methyl]indole-2-carboxamide (PubChem CID 75444716) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-ethyl-N-[[1-(1-hydroxy-2-methylpropyl)cyclopropyl]methyl]indole-2-carboxamide.
| Compound Name | 1-ethyl-N-[[1-(1-hydroxy-2-methylpropyl)cyclopropyl]methyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 75444716 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-ethyl-N-[[1-(1-hydroxy-2-methylpropyl)cyclopropyl]methyl]indole-2-carboxamide |
| SMILES | CCn1c(C(=O)NCC2(C(O)C(C)C)CC2)cc2ccccc21 |
| InChI | InChI=1S/C19H26N2O2/c1-4-21-15-8-6-5-7-14(15)11-16(21)18(23)20-12-19(9-10-19)17(22)13(2)3/h5-8,11,13,17,22H,4,9-10,12H2,1-3H3,(H,20,23) |
| InChIKey | RDNYAIHLGVAJJE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |