C17H24N2S — CID 75445228
N-(1,3-benzothiazol-2-ylmethyl)-N-methylcyclooctanamine (PubChem CID 75445228) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylmethyl)-N-methylcyclooctanamine.
| Compound Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methylcyclooctanamine |
|---|---|
| PubChem CID | 75445228 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylmethyl)-N-methylcyclooctanamine |
| SMILES | CN(Cc1nc2ccccc2s1)C1CCCCCCC1 |
| InChI | InChI=1S/C17H24N2S/c1-19(14-9-5-3-2-4-6-10-14)13-17-18-15-11-7-8-12-16(15)20-17/h7-8,11-12,14H,2-6,9-10,13H2,1H3 |
| InChIKey | ATBKKJSELPGSTJ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |