methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate

C10H14O4S — CID 75445322

IUPACmethyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate
SMILESCOC(=O)c1sc(C)cc1OCCCO
InChIInChI=1S/C10H14O4S/c1-7-6-8(14-5-3-4-11)9(15-7)10(12)13-2/h6,11H,3-5H2,1-2H3
InChIKeyYQNVQTJDGLSPOQ-UHFFFAOYSA-N
MW230.28 g/mol
LogP1.60
Rot. Bonds5

About methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate

methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate (PubChem CID 75445322) has the molecular formula C10H14O4S and a molecular weight of 230.28 g/mol. Its IUPAC name is methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate
PubChem CID75445322
Molecular FormulaC10H14O4S
Molecular Weight230.28 g/mol
Exact Mass230.06
IUPAC Namemethyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate
SMILESCOC(=O)c1sc(C)cc1OCCCO
InChIInChI=1S/C10H14O4S/c1-7-6-8(14-5-3-4-11)9(15-7)10(12)13-2/h6,11H,3-5H2,1-2H3
InChIKeyYQNVQTJDGLSPOQ-UHFFFAOYSA-N
XLogP1.60
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.28
LogP ≤ 51.60
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate?
The IUPAC name of methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate (CID 75445322) is methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate.
What is the SMILES notation for methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate?
The canonical SMILES for methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate is COC(=O)c1sc(C)cc1OCCCO.
What is the InChIKey of methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate?
The InChIKey is YQNVQTJDGLSPOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O4S/c1-7-6-8(14-5-3-4-11)9(15-7)10(12)13-2/h6,11H,3-5H2,1-2H3.
What are the key properties of methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate?
methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate has a molecular weight of 230.28 g/mol, XLogP of 1.60, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-hydroxypropoxy)-5-methylthiophene-2-carboxylate is sourced from PubChem (CID 75445322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).