C18H29NO3 — CID 75445674
1-[1-[[(3-ethoxy-4-methoxyphenyl)methylamino]methyl]cyclopropyl]-2-methylpropan-1-ol (PubChem CID 75445674) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 1-[1-[[(3-ethoxy-4-methoxyphenyl)methylamino]methyl]cyclopropyl]-2-methylpropan-1-ol.
| Compound Name | 1-[1-[[(3-ethoxy-4-methoxyphenyl)methylamino]methyl]cyclopropyl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 75445674 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 1-[1-[[(3-ethoxy-4-methoxyphenyl)methylamino]methyl]cyclopropyl]-2-methylpropan-1-ol |
| SMILES | CCOc1cc(CNCC2(C(O)C(C)C)CC2)ccc1OC |
| InChI | InChI=1S/C18H29NO3/c1-5-22-16-10-14(6-7-15(16)21-4)11-19-12-18(8-9-18)17(20)13(2)3/h6-7,10,13,17,19-20H,5,8-9,11-12H2,1-4H3 |
| InChIKey | MDXJZWZLCKPBIR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |