About N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine
N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine (PubChem CID 75446055) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine.
Molecular Properties
| Compound Name | N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine |
| PubChem CID | 75446055 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine |
| SMILES | CCCCc1nnc(NCc2ccccc2)o1 |
| InChI | InChI=1S/C13H17N3O/c1-2-3-9-12-15-16-13(17-12)14-10-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,14,16) |
| InChIKey | QTUJCZLIZADKOA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine?
The IUPAC name of N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine (CID 75446055) is N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine.
What is the SMILES notation for N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine?
The canonical SMILES for N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine is CCCCc1nnc(NCc2ccccc2)o1.
What is the InChIKey of N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine?
The InChIKey is QTUJCZLIZADKOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-2-3-9-12-15-16-13(17-12)14-10-11-7-5-4-6-8-11/h4-8H,2-3,9-10H2,1H3,(H,14,16).
What are the key properties of N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine?
N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine has a molecular weight of 231.30 g/mol, XLogP of 3.02, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-5-butyl-1,3,4-oxadiazol-2-amine is sourced from PubChem (CID 75446055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).