C20H22N4O4 — CID 7544617
N-[3-[[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]phenyl]acetamide (PubChem CID 7544617) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N-[3-[[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]phenyl]acetamide.
| Compound Name | N-[3-[[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]phenyl]acetamide |
|---|---|
| PubChem CID | 7544617 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N-[3-[[(3R)-1-(3-methoxyphenyl)-5-oxopyrrolidin-3-yl]carbamoylamino]phenyl]acetamide |
| SMILES | COc1cccc(N2C[C@H](NC(=O)Nc3cccc(NC(C)=O)c3)CC2=O)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-13(25)21-14-5-3-6-15(9-14)22-20(27)23-16-10-19(26)24(12-16)17-7-4-8-18(11-17)28-2/h3-9,11,16H,10,12H2,1-2H3,(H,21,25)(H2,22,23,27)/t16-/m1/s1 |
| InChIKey | BGIQMDNBXZMOFK-MRXNPFEDSA-N |
| XLogP | 2.58 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |