About tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate
tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate (PubChem CID 75447083) has the molecular formula C13H22ClN3O2
and a molecular weight of 287.79 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate.
Molecular Properties
| Compound Name | tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate |
| PubChem CID | 75447083 |
| Molecular Formula | C13H22ClN3O2 |
| Molecular Weight | 287.79 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate |
| SMILES | Cc1nn(C)c(Cl)c1CN[C@H](C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H22ClN3O2/c1-8-10(11(14)17(6)16-8)7-15-9(2)12(18)19-13(3,4)5/h9,15H,7H2,1-6H3/t9-/m1/s1 |
| InChIKey | PSSOIUIYQAPDGE-SECBINFHSA-N |
| XLogP | 2.20 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate?
The IUPAC name of tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate (CID 75447083) is tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate.
What is the SMILES notation for tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate?
The canonical SMILES for tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate is Cc1nn(C)c(Cl)c1CN[C@H](C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate?
The InChIKey is PSSOIUIYQAPDGE-SECBINFHSA-N. The full InChI is InChI=1S/C13H22ClN3O2/c1-8-10(11(14)17(6)16-8)7-15-9(2)12(18)19-13(3,4)5/h9,15H,7H2,1-6H3/t9-/m1/s1.
What are the key properties of tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate?
tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate has a molecular weight of 287.79 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2R)-2-[(5-chloro-1,3-dimethylpyrazol-4-yl)methylamino]propanoate is sourced from PubChem (CID 75447083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).