About 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide
2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide (PubChem CID 75447148) has the molecular formula C12H14N4O2S
and a molecular weight of 278.34 g/mol. Its IUPAC name is 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide |
| PubChem CID | 75447148 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide |
| SMILES | COc1ncc(NCc2csc(C)n2)cc1C(N)=O |
| InChI | InChI=1S/C12H14N4O2S/c1-7-16-9(6-19-7)5-14-8-3-10(11(13)17)12(18-2)15-4-8/h3-4,6,14H,5H2,1-2H3,(H2,13,17) |
| InChIKey | ZMOYRMLISOUNIZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide?
The IUPAC name of 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide (CID 75447148) is 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide.
What is the SMILES notation for 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide?
The canonical SMILES for 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide is COc1ncc(NCc2csc(C)n2)cc1C(N)=O.
What is the InChIKey of 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide?
The InChIKey is ZMOYRMLISOUNIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4O2S/c1-7-16-9(6-19-7)5-14-8-3-10(11(13)17)12(18-2)15-4-8/h3-4,6,14H,5H2,1-2H3,(H2,13,17).
What are the key properties of 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide?
2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide has a molecular weight of 278.34 g/mol, XLogP of 1.57, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-5-[(2-methyl-1,3-thiazol-4-yl)methylamino]pyridine-3-carboxamide is sourced from PubChem (CID 75447148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).