About 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea
1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea (PubChem CID 75447177) has the molecular formula C14H19N5O2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea.
Molecular Properties
| Compound Name | 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea |
| PubChem CID | 75447177 |
| Molecular Formula | C14H19N5O2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea |
| SMILES | Cc1[nH]nc2ncc(NC(=O)NC3(C)CCOCC3)cc12 |
| InChI | InChI=1S/C14H19N5O2/c1-9-11-7-10(8-15-12(11)19-18-9)16-13(20)17-14(2)3-5-21-6-4-14/h7-8H,3-6H2,1-2H3,(H,15,18,19)(H2,16,17,20) |
| InChIKey | QNXRWCPJKKLGHX-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea?
The IUPAC name of 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea (CID 75447177) is 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea.
What is the SMILES notation for 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea?
The canonical SMILES for 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea is Cc1[nH]nc2ncc(NC(=O)NC3(C)CCOCC3)cc12.
What is the InChIKey of 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea?
The InChIKey is QNXRWCPJKKLGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N5O2/c1-9-11-7-10(8-15-12(11)19-18-9)16-13(20)17-14(2)3-5-21-6-4-14/h7-8H,3-6H2,1-2H3,(H,15,18,19)(H2,16,17,20).
What are the key properties of 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea?
1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea has a molecular weight of 289.34 g/mol, XLogP of 1.96, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-methyloxan-4-yl)-3-(3-methyl-2H-pyrazolo[3,4-b]pyridin-5-yl)urea is sourced from PubChem (CID 75447177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).