C14H20F3N3O — CID 75448260
N-but-3-en-2-yl-2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanamide (PubChem CID 75448260) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is N-but-3-en-2-yl-2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanamide.
| Compound Name | N-but-3-en-2-yl-2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanamide |
|---|---|
| PubChem CID | 75448260 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | N-but-3-en-2-yl-2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]propanamide |
| SMILES | C=CC(C)NC(=O)C(C)c1c(C)nn(CC(F)(F)F)c1C |
| InChI | InChI=1S/C14H20F3N3O/c1-6-8(2)18-13(21)9(3)12-10(4)19-20(11(12)5)7-14(15,16)17/h6,8-9H,1,7H2,2-5H3,(H,18,21) |
| InChIKey | DYLSVOAYUDSKTO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|