C10H9F2N3O3S — CID 75448330
N-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,6-difluorobenzenesulfonamide (PubChem CID 75448330) has the molecular formula C10H9F2N3O3S and a molecular weight of 289.26 g/mol. Its IUPAC name is N-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,6-difluorobenzenesulfonamide.
| Compound Name | N-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 75448330 |
| Molecular Formula | C10H9F2N3O3S |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,6-difluorobenzenesulfonamide |
| SMILES | CCc1nc(NS(=O)(=O)c2c(F)cccc2F)no1 |
| InChI | InChI=1S/C10H9F2N3O3S/c1-2-8-13-10(14-18-8)15-19(16,17)9-6(11)4-3-5-7(9)12/h3-5H,2H2,1H3,(H,14,15) |
| InChIKey | SABIWWPKPTXGHD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |