C21H33N3O3 — CID 75448405
2-[(2-hydroxycyclohexyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)propanamide (PubChem CID 75448405) has the molecular formula C21H33N3O3 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-[(2-hydroxycyclohexyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 2-[(2-hydroxycyclohexyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 75448405 |
| Molecular Formula | C21H33N3O3 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.25 |
| IUPAC Name | 2-[(2-hydroxycyclohexyl)methyl-methylamino]-N-(4-morpholin-4-ylphenyl)propanamide |
| SMILES | CC(C(=O)Nc1ccc(N2CCOCC2)cc1)N(C)CC1CCCCC1O |
| InChI | InChI=1S/C21H33N3O3/c1-16(23(2)15-17-5-3-4-6-20(17)25)21(26)22-18-7-9-19(10-8-18)24-11-13-27-14-12-24/h7-10,16-17,20,25H,3-6,11-15H2,1-2H3,(H,22,26) |
| InChIKey | NFOPZTMDPROIGN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|