About 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide
3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide (PubChem CID 75448521) has the molecular formula C16H24N2O3S
and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide.
Molecular Properties
| Compound Name | 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide |
| PubChem CID | 75448521 |
| Molecular Formula | C16H24N2O3S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide |
| SMILES | Cc1ccc(C(N)=O)cc1NS(=O)(=O)C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C16H24N2O3S/c1-11-4-5-12(15(17)19)10-14(11)18-22(20,21)13-6-8-16(2,3)9-7-13/h4-5,10,13,18H,6-9H2,1-3H3,(H2,17,19) |
| InChIKey | BGKUXDOZTZFULN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide?
The IUPAC name of 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide (CID 75448521) is 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide.
What is the SMILES notation for 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide?
The canonical SMILES for 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide is Cc1ccc(C(N)=O)cc1NS(=O)(=O)C1CCC(C)(C)CC1.
What is the InChIKey of 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide?
The InChIKey is BGKUXDOZTZFULN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2O3S/c1-11-4-5-12(15(17)19)10-14(11)18-22(20,21)13-6-8-16(2,3)9-7-13/h4-5,10,13,18H,6-9H2,1-3H3,(H2,17,19).
What are the key properties of 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide?
3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide has a molecular weight of 324.45 g/mol, XLogP of 2.80, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4,4-dimethylcyclohexyl)sulfonylamino]-4-methylbenzamide is sourced from PubChem (CID 75448521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).