About 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine
1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine (PubChem CID 75448661) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine |
| PubChem CID | 75448661 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine |
| SMILES | O=S(=O)(c1ccccc1)N1CCCC(Cn2cncn2)C1 |
| InChI | InChI=1S/C14H18N4O2S/c19-21(20,14-6-2-1-3-7-14)18-8-4-5-13(10-18)9-17-12-15-11-16-17/h1-3,6-7,11-13H,4-5,8-10H2 |
| InChIKey | KFFOEDOCCFHLEX-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine?
The IUPAC name of 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine (CID 75448661) is 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine.
What is the SMILES notation for 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine?
The canonical SMILES for 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine is O=S(=O)(c1ccccc1)N1CCCC(Cn2cncn2)C1.
What is the InChIKey of 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine?
The InChIKey is KFFOEDOCCFHLEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c19-21(20,14-6-2-1-3-7-14)18-8-4-5-13(10-18)9-17-12-15-11-16-17/h1-3,6-7,11-13H,4-5,8-10H2.
What are the key properties of 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine?
1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine has a molecular weight of 306.39 g/mol, XLogP of 1.38, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-(1,2,4-triazol-1-ylmethyl)piperidine is sourced from PubChem (CID 75448661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).