About (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate
(5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate (PubChem CID 75448900) has the molecular formula C16H14N2O3S
and a molecular weight of 314.37 g/mol. Its IUPAC name is (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate |
| PubChem CID | 75448900 |
| Molecular Formula | C16H14N2O3S |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate |
| SMILES | Cc1cnc(COC(=O)c2nc(C)sc2-c2ccccc2)o1 |
| InChI | InChI=1S/C16H14N2O3S/c1-10-8-17-13(21-10)9-20-16(19)14-15(22-11(2)18-14)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3 |
| InChIKey | PGUJRVPPIHGVAA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
The IUPAC name of (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate (CID 75448900) is (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate.
What is the SMILES notation for (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
The canonical SMILES for (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate is Cc1cnc(COC(=O)c2nc(C)sc2-c2ccccc2)o1.
What is the InChIKey of (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
The InChIKey is PGUJRVPPIHGVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2O3S/c1-10-8-17-13(21-10)9-20-16(19)14-15(22-11(2)18-14)12-6-4-3-5-7-12/h3-8H,9H2,1-2H3.
What are the key properties of (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate?
(5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate has a molecular weight of 314.37 g/mol, XLogP of 3.77, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-oxazol-2-yl)methyl 2-methyl-5-phenyl-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 75448900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).