C17H15N3O2 — CID 75449878
N-benzyl-5-methyl-N-pyridin-4-yl-1,3-oxazole-4-carboxamide (PubChem CID 75449878) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is N-benzyl-5-methyl-N-pyridin-4-yl-1,3-oxazole-4-carboxamide.
| Compound Name | N-benzyl-5-methyl-N-pyridin-4-yl-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 75449878 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-benzyl-5-methyl-N-pyridin-4-yl-1,3-oxazole-4-carboxamide |
| SMILES | Cc1ocnc1C(=O)N(Cc1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C17H15N3O2/c1-13-16(19-12-22-13)17(21)20(15-7-9-18-10-8-15)11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3 |
| InChIKey | PWSFSTOBRPGZFN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |