C20H23FN2O3 — CID 75450351
tert-butyl 2-[2-(4-fluorophenyl)morpholin-4-yl]pyridine-4-carboxylate (PubChem CID 75450351) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is tert-butyl 2-[2-(4-fluorophenyl)morpholin-4-yl]pyridine-4-carboxylate.
| Compound Name | tert-butyl 2-[2-(4-fluorophenyl)morpholin-4-yl]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 75450351 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl 2-[2-(4-fluorophenyl)morpholin-4-yl]pyridine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1ccnc(N2CCOC(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C20H23FN2O3/c1-20(2,3)26-19(24)15-8-9-22-18(12-15)23-10-11-25-17(13-23)14-4-6-16(21)7-5-14/h4-9,12,17H,10-11,13H2,1-3H3 |
| InChIKey | UWOHNMUILFNOHM-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |