C20H27N5O3 — CID 75450406
(1-methylimidazol-2-yl)-[4-[methyl-[1-(1-methylpiperidin-4-yl)ethyl]amino]-3-nitrophenyl]methanone (PubChem CID 75450406) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is (1-methylimidazol-2-yl)-[4-[methyl-[1-(1-methylpiperidin-4-yl)ethyl]amino]-3-nitrophenyl]methanone.
| Compound Name | (1-methylimidazol-2-yl)-[4-[methyl-[1-(1-methylpiperidin-4-yl)ethyl]amino]-3-nitrophenyl]methanone |
|---|---|
| PubChem CID | 75450406 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | (1-methylimidazol-2-yl)-[4-[methyl-[1-(1-methylpiperidin-4-yl)ethyl]amino]-3-nitrophenyl]methanone |
| SMILES | CC(C1CCN(C)CC1)N(C)c1ccc(C(=O)c2nccn2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H27N5O3/c1-14(15-7-10-22(2)11-8-15)24(4)17-6-5-16(13-18(17)25(27)28)19(26)20-21-9-12-23(20)3/h5-6,9,12-15H,7-8,10-11H2,1-4H3 |
| InChIKey | BWEFFDBNDCOWQU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|