C17H20N2O3 — CID 75450735
2,2-dimethylpent-4-ynyl 4-(2-oxoimidazolidin-1-yl)benzoate (PubChem CID 75450735) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2,2-dimethylpent-4-ynyl 4-(2-oxoimidazolidin-1-yl)benzoate.
| Compound Name | 2,2-dimethylpent-4-ynyl 4-(2-oxoimidazolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 75450735 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 2,2-dimethylpent-4-ynyl 4-(2-oxoimidazolidin-1-yl)benzoate |
| SMILES | C#CCC(C)(C)COC(=O)c1ccc(N2CCNC2=O)cc1 |
| InChI | InChI=1S/C17H20N2O3/c1-4-9-17(2,3)12-22-15(20)13-5-7-14(8-6-13)19-11-10-18-16(19)21/h1,5-8H,9-12H2,2-3H3,(H,18,21) |
| InChIKey | MEJHMYDDPWBWBK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|