About (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate
(1-cyano-2-methylpropyl) quinoxaline-6-carboxylate (PubChem CID 75450836) has the molecular formula C14H13N3O2
and a molecular weight of 255.28 g/mol. Its IUPAC name is (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate.
Molecular Properties
| Compound Name | (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate |
| PubChem CID | 75450836 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate |
| SMILES | CC(C)C(C#N)OC(=O)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C14H13N3O2/c1-9(2)13(8-15)19-14(18)10-3-4-11-12(7-10)17-6-5-16-11/h3-7,9,13H,1-2H3 |
| InChIKey | MNMOLGWJOWZTCT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate?
The IUPAC name of (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate (CID 75450836) is (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate.
What is the SMILES notation for (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate?
The canonical SMILES for (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate is CC(C)C(C#N)OC(=O)c1ccc2nccnc2c1.
What is the InChIKey of (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate?
The InChIKey is MNMOLGWJOWZTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N3O2/c1-9(2)13(8-15)19-14(18)10-3-4-11-12(7-10)17-6-5-16-11/h3-7,9,13H,1-2H3.
What are the key properties of (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate?
(1-cyano-2-methylpropyl) quinoxaline-6-carboxylate has a molecular weight of 255.28 g/mol, XLogP of 2.33, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-2-methylpropyl) quinoxaline-6-carboxylate is sourced from PubChem (CID 75450836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).