C17H17NO5 — CID 754510
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5-dimethoxybenzamide (PubChem CID 754510) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 754510 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3c(c2)OCCO3)c1 |
| InChI | InChI=1S/C17H17NO5/c1-20-13-7-11(8-14(10-13)21-2)17(19)18-12-3-4-15-16(9-12)23-6-5-22-15/h3-4,7-10H,5-6H2,1-2H3,(H,18,19) |
| InChIKey | RSKSQSMKHRXHAP-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |