About 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride
3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride (PubChem CID 75451127) has the molecular formula C8H14ClN3O3
and a molecular weight of 235.67 g/mol. Its IUPAC name is 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride.
Molecular Properties
| Compound Name | 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride |
| PubChem CID | 75451127 |
| Molecular Formula | C8H14ClN3O3 |
| Molecular Weight | 235.67 g/mol |
| Exact Mass | 235.07 |
| IUPAC Name | 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride |
| SMILES | COCc1nc(C2COCCN2)no1.Cl |
| InChI | InChI=1S/C8H13N3O3.ClH/c1-12-5-7-10-8(11-14-7)6-4-13-3-2-9-6;/h6,9H,2-5H2,1H3;1H |
| InChIKey | HGQPRVUSQPSVAA-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.67 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride?
The IUPAC name of 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride (CID 75451127) is 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride.
What is the SMILES notation for 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride?
The canonical SMILES for 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride is COCc1nc(C2COCCN2)no1.Cl.
What is the InChIKey of 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride?
The InChIKey is HGQPRVUSQPSVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3.ClH/c1-12-5-7-10-8(11-14-7)6-4-13-3-2-9-6;/h6,9H,2-5H2,1H3;1H.
What are the key properties of 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride?
3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride has a molecular weight of 235.67 g/mol, XLogP of 0.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(methoxymethyl)-1,2,4-oxadiazol-3-yl]morpholine;hydrochloride is sourced from PubChem (CID 75451127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).