About N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide
N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide (PubChem CID 75451258) has the molecular formula C12H19N3O4S
and a molecular weight of 301.37 g/mol. Its IUPAC name is N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide.
Molecular Properties
| Compound Name | N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide |
| PubChem CID | 75451258 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide |
| SMILES | Cc1n[nH]c(=O)c(CNS(=O)(=O)C2CCOCC2)c1C |
| InChI | InChI=1S/C12H19N3O4S/c1-8-9(2)14-15-12(16)11(8)7-13-20(17,18)10-3-5-19-6-4-10/h10,13H,3-7H2,1-2H3,(H,15,16) |
| InChIKey | MCQHRZLYHJXRPL-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide?
The IUPAC name of N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide (CID 75451258) is N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide.
What is the SMILES notation for N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide?
The canonical SMILES for N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide is Cc1n[nH]c(=O)c(CNS(=O)(=O)C2CCOCC2)c1C.
What is the InChIKey of N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide?
The InChIKey is MCQHRZLYHJXRPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O4S/c1-8-9(2)14-15-12(16)11(8)7-13-20(17,18)10-3-5-19-6-4-10/h10,13H,3-7H2,1-2H3,(H,15,16).
What are the key properties of N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide?
N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide has a molecular weight of 301.37 g/mol, XLogP of -0.01, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3,4-dimethyl-6-oxo-1H-pyridazin-5-yl)methyl]oxane-4-sulfonamide is sourced from PubChem (CID 75451258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).