C11H10ClN3O2S — CID 75451266
2-chloro-4-cyano-N-(cyanomethyl)-N-ethylbenzenesulfonamide (PubChem CID 75451266) has the molecular formula C11H10ClN3O2S and a molecular weight of 283.74 g/mol. Its IUPAC name is 2-chloro-4-cyano-N-(cyanomethyl)-N-ethylbenzenesulfonamide.
| Compound Name | 2-chloro-4-cyano-N-(cyanomethyl)-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 75451266 |
| Molecular Formula | C11H10ClN3O2S |
| Molecular Weight | 283.74 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 2-chloro-4-cyano-N-(cyanomethyl)-N-ethylbenzenesulfonamide |
| SMILES | CCN(CC#N)S(=O)(=O)c1ccc(C#N)cc1Cl |
| InChI | InChI=1S/C11H10ClN3O2S/c1-2-15(6-5-13)18(16,17)11-4-3-9(8-14)7-10(11)12/h3-4,7H,2,6H2,1H3 |
| InChIKey | NVIQFBXBJHBJLE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 84.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.74 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|