C17H14N6O4 — CID 75452261
2-[(3-cyano-2-pyridinyl)amino]ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate (PubChem CID 75452261) has the molecular formula C17H14N6O4 and a molecular weight of 366.34 g/mol. Its IUPAC name is 2-[(3-cyano-2-pyridinyl)amino]ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate.
| Compound Name | 2-[(3-cyano-2-pyridinyl)amino]ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 75452261 |
| Molecular Formula | C17H14N6O4 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | 2-[(3-cyano-2-pyridinyl)amino]ethyl 1-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-6-carboxylate |
| SMILES | Cn1c(=O)[nH]c(=O)c2cc(C(=O)OCCNc3ncccc3C#N)cnc21 |
| InChI | InChI=1S/C17H14N6O4/c1-23-14-12(15(24)22-17(23)26)7-11(9-21-14)16(25)27-6-5-20-13-10(8-18)3-2-4-19-13/h2-4,7,9H,5-6H2,1H3,(H,19,20)(H,22,24,26) |
| InChIKey | JIJWYDQLHMLJIW-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 142.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|