C18H27N3O4 — CID 75453471
3-[2,2-dimethoxyethyl-[[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]methyl]amino]propan-1-ol (PubChem CID 75453471) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[2,2-dimethoxyethyl-[[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]methyl]amino]propan-1-ol.
| Compound Name | 3-[2,2-dimethoxyethyl-[[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]methyl]amino]propan-1-ol |
|---|---|
| PubChem CID | 75453471 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-[2,2-dimethoxyethyl-[[3-(2-phenylethyl)-1,2,4-oxadiazol-5-yl]methyl]amino]propan-1-ol |
| SMILES | COC(CN(CCCO)Cc1nc(CCc2ccccc2)no1)OC |
| InChI | InChI=1S/C18H27N3O4/c1-23-18(24-2)14-21(11-6-12-22)13-17-19-16(20-25-17)10-9-15-7-4-3-5-8-15/h3-5,7-8,18,22H,6,9-14H2,1-2H3 |
| InChIKey | CHDJEAXUXXVRMH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|