About 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine
3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine (PubChem CID 75453550) has the molecular formula C12H19N3O
and a molecular weight of 221.30 g/mol. Its IUPAC name is 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine.
Molecular Properties
| Compound Name | 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine |
| PubChem CID | 75453550 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine |
| SMILES | CCOc1ccc(N2CCC(C)(C)C2)nn1 |
| InChI | InChI=1S/C12H19N3O/c1-4-16-11-6-5-10(13-14-11)15-8-7-12(2,3)9-15/h5-6H,4,7-9H2,1-3H3 |
| InChIKey | VNZAXOHEJWVJNX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine?
The IUPAC name of 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine (CID 75453550) is 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine.
What is the SMILES notation for 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine?
The canonical SMILES for 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine is CCOc1ccc(N2CCC(C)(C)C2)nn1.
What is the InChIKey of 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine?
The InChIKey is VNZAXOHEJWVJNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O/c1-4-16-11-6-5-10(13-14-11)15-8-7-12(2,3)9-15/h5-6H,4,7-9H2,1-3H3.
What are the key properties of 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine?
3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine has a molecular weight of 221.30 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-dimethylpyrrolidin-1-yl)-6-ethoxypyridazine is sourced from PubChem (CID 75453550), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).