About 3-(azepan-2-yl)-1,2,4-oxadiazole
3-(azepan-2-yl)-1,2,4-oxadiazole (PubChem CID 75453942) has the molecular formula C8H13N3O
and a molecular weight of 167.21 g/mol. Its IUPAC name is 3-(azepan-2-yl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-(azepan-2-yl)-1,2,4-oxadiazole |
| PubChem CID | 75453942 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 3-(azepan-2-yl)-1,2,4-oxadiazole |
| SMILES | c1nc(C2CCCCCN2)no1 |
| InChI | InChI=1S/C8H13N3O/c1-2-4-7(9-5-3-1)8-10-6-12-11-8/h6-7,9H,1-5H2 |
| InChIKey | PARYBDOLVNBMAW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(azepan-2-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(azepan-2-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-(azepan-2-yl)-1,2,4-oxadiazole (CID 75453942) is 3-(azepan-2-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-(azepan-2-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-(azepan-2-yl)-1,2,4-oxadiazole is c1nc(C2CCCCCN2)no1.
What is the InChIKey of 3-(azepan-2-yl)-1,2,4-oxadiazole?
The InChIKey is PARYBDOLVNBMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O/c1-2-4-7(9-5-3-1)8-10-6-12-11-8/h6-7,9H,1-5H2.
What are the key properties of 3-(azepan-2-yl)-1,2,4-oxadiazole?
3-(azepan-2-yl)-1,2,4-oxadiazole has a molecular weight of 167.21 g/mol, XLogP of 1.27, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(azepan-2-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 75453942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).