C20H15N3O3S — CID 75454348
N-[3-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzenesulfonamide (PubChem CID 75454348) has the molecular formula C20H15N3O3S and a molecular weight of 377.43 g/mol. Its IUPAC name is N-[3-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzenesulfonamide.
| Compound Name | N-[3-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 75454348 |
| Molecular Formula | C20H15N3O3S |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | N-[3-(3-oxo-4H-quinoxalin-2-yl)phenyl]benzenesulfonamide |
| SMILES | O=c1[nH]c2ccccc2nc1-c1cccc(NS(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H15N3O3S/c24-20-19(21-17-11-4-5-12-18(17)22-20)14-7-6-8-15(13-14)23-27(25,26)16-9-2-1-3-10-16/h1-13,23H,(H,22,24) |
| InChIKey | CRCACKDTBFJOQM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |