About 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride
4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride (PubChem CID 75454618) has the molecular formula C14H12ClFN2O3
and a molecular weight of 310.71 g/mol. Its IUPAC name is 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride.
Molecular Properties
| Compound Name | 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride |
| PubChem CID | 75454618 |
| Molecular Formula | C14H12ClFN2O3 |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride |
| SMILES | O=c1[nH]c2c(ccc[n+]2CCOc2cccc(F)c2)o1.[Cl-] |
| InChI | InChI=1S/C14H11FN2O3.ClH/c15-10-3-1-4-11(9-10)19-8-7-17-6-2-5-12-13(17)16-14(18)20-12;/h1-6,9H,7-8H2;1H |
| InChIKey | PPRSKEGQTWKKHI-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 59.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride?
The IUPAC name of 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride (CID 75454618) is 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride.
What is the SMILES notation for 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride?
The canonical SMILES for 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride is O=c1[nH]c2c(ccc[n+]2CCOc2cccc(F)c2)o1.[Cl-].
What is the InChIKey of 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride?
The InChIKey is PPRSKEGQTWKKHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FN2O3.ClH/c15-10-3-1-4-11(9-10)19-8-7-17-6-2-5-12-13(17)16-14(18)20-12;/h1-6,9H,7-8H2;1H.
What are the key properties of 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride?
4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride has a molecular weight of 310.71 g/mol, XLogP of -1.37, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3-fluorophenoxy)ethyl]-3H-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-one chloride is sourced from PubChem (CID 75454618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).