C15H15BrClN3O3S — CID 75454717
N-(3-bromo-2-pyridinyl)-2-[(4-chlorophenyl)sulfonyl-methylamino]-N-methylacetamide (PubChem CID 75454717) has the molecular formula C15H15BrClN3O3S and a molecular weight of 432.73 g/mol. Its IUPAC name is N-(3-bromo-2-pyridinyl)-2-[(4-chlorophenyl)sulfonyl-methylamino]-N-methylacetamide.
| Compound Name | N-(3-bromo-2-pyridinyl)-2-[(4-chlorophenyl)sulfonyl-methylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 75454717 |
| Molecular Formula | C15H15BrClN3O3S |
| Molecular Weight | 432.73 g/mol |
| Exact Mass | 430.97 |
| IUPAC Name | N-(3-bromo-2-pyridinyl)-2-[(4-chlorophenyl)sulfonyl-methylamino]-N-methylacetamide |
| SMILES | CN(C(=O)CN(C)S(=O)(=O)c1ccc(Cl)cc1)c1ncccc1Br |
| InChI | InChI=1S/C15H15BrClN3O3S/c1-19(24(22,23)12-7-5-11(17)6-8-12)10-14(21)20(2)15-13(16)4-3-9-18-15/h3-9H,10H2,1-2H3 |
| InChIKey | GROFGBYVFLRRMO-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.73 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |