C20H24FN3O2 — CID 75454991
3-N-ethyl-1-N-[3-(3-fluoroanilino)propyl]-3-N-methylbenzene-1,3-dicarboxamide (PubChem CID 75454991) has the molecular formula C20H24FN3O2 and a molecular weight of 357.43 g/mol. Its IUPAC name is 3-N-ethyl-1-N-[3-(3-fluoroanilino)propyl]-3-N-methylbenzene-1,3-dicarboxamide.
| Compound Name | 3-N-ethyl-1-N-[3-(3-fluoroanilino)propyl]-3-N-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 75454991 |
| Molecular Formula | C20H24FN3O2 |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 3-N-ethyl-1-N-[3-(3-fluoroanilino)propyl]-3-N-methylbenzene-1,3-dicarboxamide |
| SMILES | CCN(C)C(=O)c1cccc(C(=O)NCCCNc2cccc(F)c2)c1 |
| InChI | InChI=1S/C20H24FN3O2/c1-3-24(2)20(26)16-8-4-7-15(13-16)19(25)23-12-6-11-22-18-10-5-9-17(21)14-18/h4-5,7-10,13-14,22H,3,6,11-12H2,1-2H3,(H,23,25) |
| InChIKey | QOUKIMHPPQTXFK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|